C24H26N4O6S — CID 124836360
ethyl 4-[(1R,5S,6R,7R)-3-(5-methoxy-1,3-benzothiazol-2-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carbonyl]piperazine-1-carboxylate (PubChem CID 124836360) has the molecular formula C24H26N4O6S and a molecular weight of 498.56 g/mol. Its IUPAC name is ethyl 4-[(1R,5S,6R,7R)-3-(5-methoxy-1,3-benzothiazol-2-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(1R,5S,6R,7R)-3-(5-methoxy-1,3-benzothiazol-2-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 124836360 |
| Molecular Formula | C24H26N4O6S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | ethyl 4-[(1R,5S,6R,7R)-3-(5-methoxy-1,3-benzothiazol-2-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)[C@H]2[C@H]3C=C[C@@]4(CN(c5nc6cc(OC)ccc6s5)C(=O)[C@@H]24)O3)CC1 |
| InChI | InChI=1S/C24H26N4O6S/c1-3-33-23(31)27-10-8-26(9-11-27)20(29)18-16-6-7-24(34-16)13-28(21(30)19(18)24)22-25-15-12-14(32-2)4-5-17(15)35-22/h4-7,12,16,18-19H,3,8-11,13H2,1-2H3/t16-,18+,19-,24+/m1/s1 |
| InChIKey | BPQLHNFWBGIOHV-YRHGQSLTSA-N |
| XLogP | 1.89 |
| TPSA | 101.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|