C8H8N2O — CID 124836440
(1S,3R,4R,6R)-7-oxabicyclo[4.1.0]heptane-3,4-dicarbonitrile (PubChem CID 124836440) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is (1S,3R,4R,6R)-7-oxabicyclo[4.1.0]heptane-3,4-dicarbonitrile.
| Compound Name | (1S,3R,4R,6R)-7-oxabicyclo[4.1.0]heptane-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 124836440 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | (1S,3R,4R,6R)-7-oxabicyclo[4.1.0]heptane-3,4-dicarbonitrile |
| SMILES | N#C[C@@H]1C[C@@H]2O[C@@H]2C[C@H]1C#N |
| InChI | InChI=1S/C8H8N2O/c9-3-5-1-7-8(11-7)2-6(5)4-10/h5-8H,1-2H2/t5-,6-,7-,8+/m0/s1 |
| InChIKey | FDXCSFQACVFEJJ-DKXJUACHSA-N |
| XLogP | 0.83 |
| TPSA | 60.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|