C27H26O — CID 124837016
(1S,2S,6R,7S,8S,11R)-2,4-dimethyl-5,6-diphenyltetracyclo[5.4.2.02,6.08,11]trideca-4,12-dien-3-one (PubChem CID 124837016) has the molecular formula C27H26O and a molecular weight of 366.50 g/mol. Its IUPAC name is (1S,2S,6R,7S,8S,11R)-2,4-dimethyl-5,6-diphenyltetracyclo[5.4.2.02,6.08,11]trideca-4,12-dien-3-one.
| Compound Name | (1S,2S,6R,7S,8S,11R)-2,4-dimethyl-5,6-diphenyltetracyclo[5.4.2.02,6.08,11]trideca-4,12-dien-3-one |
|---|---|
| PubChem CID | 124837016 |
| Molecular Formula | C27H26O |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (1S,2S,6R,7S,8S,11R)-2,4-dimethyl-5,6-diphenyltetracyclo[5.4.2.02,6.08,11]trideca-4,12-dien-3-one |
| SMILES | CC1=C(c2ccccc2)[C@]2(c3ccccc3)[C@H]3C=C[C@@H]([C@@H]4CC[C@@H]43)[C@]2(C)C1=O |
| InChI | InChI=1S/C27H26O/c1-17-24(18-9-5-3-6-10-18)27(19-11-7-4-8-12-19)23-16-15-22(20-13-14-21(20)23)26(27,2)25(17)28/h3-12,15-16,20-23H,13-14H2,1-2H3/t20-,21+,22+,23+,26-,27+/m1/s1 |
| InChIKey | WZOOUDLTRAKAHN-LLRKCLGTSA-N |
| XLogP | 5.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|