C22H27F2N5O — CID 124837427
N-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]phenyl]-2-[3-(difluoromethyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-1-yl]acetamide (PubChem CID 124837427) has the molecular formula C22H27F2N5O and a molecular weight of 415.49 g/mol. Its IUPAC name is N-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]phenyl]-2-[3-(difluoromethyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-1-yl]acetamide.
| Compound Name | N-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]phenyl]-2-[3-(difluoromethyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 124837427 |
| Molecular Formula | C22H27F2N5O |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | N-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]phenyl]-2-[3-(difluoromethyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1nc(C(F)F)c2c1CCC2)Nc1ccc(N2CCN3CCC[C@H]3C2)cc1 |
| InChI | InChI=1S/C22H27F2N5O/c23-22(24)21-18-4-1-5-19(18)29(26-21)14-20(30)25-15-6-8-16(9-7-15)28-12-11-27-10-2-3-17(27)13-28/h6-9,17,22H,1-5,10-14H2,(H,25,30)/t17-/m0/s1 |
| InChIKey | LGZYSMIYCRLFCD-KRWDZBQOSA-N |
| XLogP | 3.23 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|