C21H28ClN3O3 — CID 124838283
2-[(4R)-4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 124838283) has the molecular formula C21H28ClN3O3 and a molecular weight of 405.93 g/mol. Its IUPAC name is 2-[(4R)-4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-[(4R)-4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 124838283 |
| Molecular Formula | C21H28ClN3O3 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-[(4R)-4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)N[C@@H]2CCC[C@@H](C)[C@H]2C)C1=O |
| InChI | InChI=1S/C21H28ClN3O3/c1-4-21(15-8-10-16(22)11-9-15)19(27)25(20(28)24-21)12-18(26)23-17-7-5-6-13(2)14(17)3/h8-11,13-14,17H,4-7,12H2,1-3H3,(H,23,26)(H,24,28)/t13-,14-,17-,21-/m1/s1 |
| InChIKey | IOSWYTZZACAJLH-DDBGFLLRSA-N |
| XLogP | 3.44 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|