C18H20N4O3 — CID 124839095
3-nitro-2-[[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]amino]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 124839095) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-nitro-2-[[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]amino]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-nitro-2-[[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]amino]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 124839095 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-nitro-2-[[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]amino]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c(N[C@@H]2C[C@H]3C[C@H]2[C@@H]2CCC[C@H]32)nc2ccccn12 |
| InChI | InChI=1S/C18H20N4O3/c23-18-16(22(24)25)17(20-15-6-1-2-7-21(15)18)19-14-9-10-8-13(14)12-5-3-4-11(10)12/h1-2,6-7,10-14,19H,3-5,8-9H2/t10-,11-,12-,13+,14-/m1/s1 |
| InChIKey | ZCBJXWWIUXMSLT-XGFWRYKXSA-N |
| XLogP | 2.84 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|