C15H23N2O2+ — CID 124839544
(1R,9R,11S)-11-[(2R)-2-hydroxypropyl]-11-methyl-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 124839544) has the molecular formula C15H23N2O2+ and a molecular weight of 263.36 g/mol. Its IUPAC name is (1R,9R,11S)-11-[(2R)-2-hydroxypropyl]-11-methyl-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9R,11S)-11-[(2R)-2-hydroxypropyl]-11-methyl-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 124839544 |
| Molecular Formula | C15H23N2O2+ |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | (1R,9R,11S)-11-[(2R)-2-hydroxypropyl]-11-methyl-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | C[C@@H](O)C[N@@+]1(C)C[C@@H]2C[C@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C15H23N2O2/c1-11(18)8-17(2)9-12-6-13(10-17)14-4-3-5-15(19)16(14)7-12/h3-5,11-13,18H,6-10H2,1-2H3/q+1/t11-,12-,13-,17+/m1/s1 |
| InChIKey | YHYFKNRSINQAGF-ZFRZLUBXSA-N |
| XLogP | 0.79 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|