C11H17N3O4S — CID 124840429
(3aS,7aS)-N-(2-cyanoethyl)-N-methyl-7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrole-1-sulfonamide (PubChem CID 124840429) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is (3aS,7aS)-N-(2-cyanoethyl)-N-methyl-7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrole-1-sulfonamide.
| Compound Name | (3aS,7aS)-N-(2-cyanoethyl)-N-methyl-7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrole-1-sulfonamide |
|---|---|
| PubChem CID | 124840429 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | (3aS,7aS)-N-(2-cyanoethyl)-N-methyl-7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrole-1-sulfonamide |
| SMILES | CN(CCC#N)S(=O)(=O)N1CC[C@H]2CCOC(=O)[C@H]21 |
| InChI | InChI=1S/C11H17N3O4S/c1-13(6-2-5-12)19(16,17)14-7-3-9-4-8-18-11(15)10(9)14/h9-10H,2-4,6-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | BYTIDYOJAMGJJR-UWVGGRQHSA-N |
| XLogP | -0.29 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |