C15H26N4O — CID 124840648
(1R,5S,6R)-N-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine (PubChem CID 124840648) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is (1R,5S,6R)-N-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine.
| Compound Name | (1R,5S,6R)-N-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine |
|---|---|
| PubChem CID | 124840648 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | (1R,5S,6R)-N-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine |
| SMILES | CCn1c(C)nnc1CN(C)[C@@H]1[C@@H]2CCO[C@H]2C1(C)C |
| InChI | InChI=1S/C15H26N4O/c1-6-19-10(2)16-17-12(19)9-18(5)13-11-7-8-20-14(11)15(13,3)4/h11,13-14H,6-9H2,1-5H3/t11-,13+,14+/m0/s1 |
| InChIKey | JCNJXPDMMYAHJT-IACUBPJLSA-N |
| XLogP | 1.85 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |