C13H21N3OS — CID 124841051
N-[(1R,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-propan-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 124841051) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is N-[(1R,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-propan-2-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[(1R,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 124841051 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-[(1R,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)c1nsc(N[C@@H]2[C@H]3CCO[C@H]3C2(C)C)n1 |
| InChI | InChI=1S/C13H21N3OS/c1-7(2)11-15-12(18-16-11)14-9-8-5-6-17-10(8)13(9,3)4/h7-10H,5-6H2,1-4H3,(H,14,15,16)/t8-,9-,10-/m1/s1 |
| InChIKey | VNVJSKDVHXNSNB-OPRDCNLKSA-N |
| XLogP | 2.89 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |