About methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate
methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate (PubChem CID 124841256) has the molecular formula C20H23NO4
and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate |
| PubChem CID | 124841256 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate |
| SMILES | COC(=O)Cc1occc1C(=O)N1C[C@H](c2ccccc2C)C[C@@H]1C |
| InChI | InChI=1S/C20H23NO4/c1-13-6-4-5-7-16(13)15-10-14(2)21(12-15)20(23)17-8-9-25-18(17)11-19(22)24-3/h4-9,14-15H,10-12H2,1-3H3/t14-,15+/m0/s1 |
| InChIKey | ACOVKDQMDFWYFY-LSDHHAIUSA-N |
| XLogP | 3.32 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate?
The IUPAC name of methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate (CID 124841256) is methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate.
What is the SMILES notation for methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate?
The canonical SMILES for methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate is COC(=O)Cc1occc1C(=O)N1C[C@H](c2ccccc2C)C[C@@H]1C.
What is the InChIKey of methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate?
The InChIKey is ACOVKDQMDFWYFY-LSDHHAIUSA-N. The full InChI is InChI=1S/C20H23NO4/c1-13-6-4-5-7-16(13)15-10-14(2)21(12-15)20(23)17-8-9-25-18(17)11-19(22)24-3/h4-9,14-15H,10-12H2,1-3H3/t14-,15+/m0/s1.
What are the key properties of methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate?
methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate has a molecular weight of 341.41 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidine-1-carbonyl]furan-2-yl]acetate is sourced from PubChem (CID 124841256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).