About methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate
methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate (PubChem CID 124841521) has the molecular formula C13H20N4O3
and a molecular weight of 280.33 g/mol. Its IUPAC name is methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate |
| PubChem CID | 124841521 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)N(C(=O)CCn1cncn1)C1CCC1 |
| InChI | InChI=1S/C13H20N4O3/c1-10(13(19)20-2)17(11-4-3-5-11)12(18)6-7-16-9-14-8-15-16/h8-11H,3-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | AQRRGUKZTYTZPV-SNVBAGLBSA-N |
| XLogP | 0.61 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate?
The IUPAC name of methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate (CID 124841521) is methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate.
What is the SMILES notation for methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate?
The canonical SMILES for methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate is COC(=O)[C@@H](C)N(C(=O)CCn1cncn1)C1CCC1.
What is the InChIKey of methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate?
The InChIKey is AQRRGUKZTYTZPV-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H20N4O3/c1-10(13(19)20-2)17(11-4-3-5-11)12(18)6-7-16-9-14-8-15-16/h8-11H,3-7H2,1-2H3/t10-/m1/s1.
What are the key properties of methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate?
methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate has a molecular weight of 280.33 g/mol, XLogP of 0.61, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[cyclobutyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]propanoate is sourced from PubChem (CID 124841521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).