C18H34N2O2 — CID 124842218
(2S,4S)-N-(4-tert-butylpiperidin-1-yl)-2-propyloxane-4-carboxamide (PubChem CID 124842218) has the molecular formula C18H34N2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is (2S,4S)-N-(4-tert-butylpiperidin-1-yl)-2-propyloxane-4-carboxamide.
| Compound Name | (2S,4S)-N-(4-tert-butylpiperidin-1-yl)-2-propyloxane-4-carboxamide |
|---|---|
| PubChem CID | 124842218 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | (2S,4S)-N-(4-tert-butylpiperidin-1-yl)-2-propyloxane-4-carboxamide |
| SMILES | CCC[C@H]1C[C@@H](C(=O)NN2CCC(C(C)(C)C)CC2)CCO1 |
| InChI | InChI=1S/C18H34N2O2/c1-5-6-16-13-14(9-12-22-16)17(21)19-20-10-7-15(8-11-20)18(2,3)4/h14-16H,5-13H2,1-4H3,(H,19,21)/t14-,16-/m0/s1 |
| InChIKey | BWFGWXORZKGPCS-HOCLYGCPSA-N |
| XLogP | 3.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |