C11H22FNO2 — CID 124842414
[(2S,6S)-4-(5-fluoropentyl)-6-methylmorpholin-2-yl]methanol (PubChem CID 124842414) has the molecular formula C11H22FNO2 and a molecular weight of 219.30 g/mol. Its IUPAC name is [(2S,6S)-4-(5-fluoropentyl)-6-methylmorpholin-2-yl]methanol.
| Compound Name | [(2S,6S)-4-(5-fluoropentyl)-6-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 124842414 |
| Molecular Formula | C11H22FNO2 |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | [(2S,6S)-4-(5-fluoropentyl)-6-methylmorpholin-2-yl]methanol |
| SMILES | C[C@H]1CN(CCCCCF)C[C@@H](CO)O1 |
| InChI | InChI=1S/C11H22FNO2/c1-10-7-13(6-4-2-3-5-12)8-11(9-14)15-10/h10-11,14H,2-9H2,1H3/t10-,11-/m0/s1 |
| InChIKey | CCHATHHODYUEIF-QWRGUYRKSA-N |
| XLogP | 1.21 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|