C14H23NO5 — CID 124842551
methyl (2S,3aR,5R,7aS)-4-(2-ethoxyacetyl)-5-methyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate (PubChem CID 124842551) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is methyl (2S,3aR,5R,7aS)-4-(2-ethoxyacetyl)-5-methyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate.
| Compound Name | methyl (2S,3aR,5R,7aS)-4-(2-ethoxyacetyl)-5-methyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 124842551 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | methyl (2S,3aR,5R,7aS)-4-(2-ethoxyacetyl)-5-methyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate |
| SMILES | CCOCC(=O)N1[C@H](C)CC[C@@H]2O[C@H](C(=O)OC)C[C@H]21 |
| InChI | InChI=1S/C14H23NO5/c1-4-19-8-13(16)15-9(2)5-6-11-10(15)7-12(20-11)14(17)18-3/h9-12H,4-8H2,1-3H3/t9-,10-,11+,12+/m1/s1 |
| InChIKey | CISJZQJWEPXTCU-WYUUTHIRSA-N |
| XLogP | 0.73 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |