C13H25N3O4S — CID 124843676
N-[2-[(4aR,8aS)-6-ethyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazin-1-yl]-2-oxoethyl]-N-methylmethanesulfonamide (PubChem CID 124843676) has the molecular formula C13H25N3O4S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-[2-[(4aR,8aS)-6-ethyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazin-1-yl]-2-oxoethyl]-N-methylmethanesulfonamide.
| Compound Name | N-[2-[(4aR,8aS)-6-ethyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazin-1-yl]-2-oxoethyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 124843676 |
| Molecular Formula | C13H25N3O4S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[2-[(4aR,8aS)-6-ethyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazin-1-yl]-2-oxoethyl]-N-methylmethanesulfonamide |
| SMILES | CCN1CC[C@H]2[C@@H](C1)OCCN2C(=O)CN(C)S(C)(=O)=O |
| InChI | InChI=1S/C13H25N3O4S/c1-4-15-6-5-11-12(9-15)20-8-7-16(11)13(17)10-14(2)21(3,18)19/h11-12H,4-10H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | FBMRPWGSMRQBBV-NWDGAFQWSA-N |
| XLogP | -0.80 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |