About 4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine
4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine (PubChem CID 124843875) has the molecular formula C11H19N3O2S
and a molecular weight of 257.36 g/mol. Its IUPAC name is 4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine |
| PubChem CID | 124843875 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine |
| SMILES | CNc1nc(CN(C)C[C@H]2COCCO2)cs1 |
| InChI | InChI=1S/C11H19N3O2S/c1-12-11-13-9(8-17-11)5-14(2)6-10-7-15-3-4-16-10/h8,10H,3-7H2,1-2H3,(H,12,13)/t10-/m0/s1 |
| InChIKey | FIDWKRBPTVQVNR-JTQLQIEISA-N |
| XLogP | 1.03 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine?
The IUPAC name of 4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine (CID 124843875) is 4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine?
The canonical SMILES for 4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine is CNc1nc(CN(C)C[C@H]2COCCO2)cs1.
What is the InChIKey of 4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine?
The InChIKey is FIDWKRBPTVQVNR-JTQLQIEISA-N. The full InChI is InChI=1S/C11H19N3O2S/c1-12-11-13-9(8-17-11)5-14(2)6-10-7-15-3-4-16-10/h8,10H,3-7H2,1-2H3,(H,12,13)/t10-/m0/s1.
What are the key properties of 4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine?
4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine has a molecular weight of 257.36 g/mol, XLogP of 1.03, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]methyl]-N-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 124843875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).