C11H18N2 — CID 124844099
(3aR,7aR)-1-tert-butyl-3a,6,7,7a-tetrahydroindazole (PubChem CID 124844099) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (3aR,7aR)-1-tert-butyl-3a,6,7,7a-tetrahydroindazole.
| Compound Name | (3aR,7aR)-1-tert-butyl-3a,6,7,7a-tetrahydroindazole |
|---|---|
| PubChem CID | 124844099 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (3aR,7aR)-1-tert-butyl-3a,6,7,7a-tetrahydroindazole |
| SMILES | CC(C)(C)N1N=C[C@@H]2C=CCC[C@H]21 |
| InChI | InChI=1S/C11H18N2/c1-11(2,3)13-10-7-5-4-6-9(10)8-12-13/h4,6,8-10H,5,7H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | FQCSCKXXMITUBH-VHSXEESVSA-N |
| XLogP | 2.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|