C20H32N4O5 — CID 124844276
methyl 4-[[(2S,3S)-1-tert-butyl-2-[1-(2-methoxyethyl)pyrazol-4-yl]-5-oxopyrrolidine-3-carbonyl]amino]butanoate (PubChem CID 124844276) has the molecular formula C20H32N4O5 and a molecular weight of 408.50 g/mol. Its IUPAC name is methyl 4-[[(2S,3S)-1-tert-butyl-2-[1-(2-methoxyethyl)pyrazol-4-yl]-5-oxopyrrolidine-3-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[(2S,3S)-1-tert-butyl-2-[1-(2-methoxyethyl)pyrazol-4-yl]-5-oxopyrrolidine-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 124844276 |
| Molecular Formula | C20H32N4O5 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | methyl 4-[[(2S,3S)-1-tert-butyl-2-[1-(2-methoxyethyl)pyrazol-4-yl]-5-oxopyrrolidine-3-carbonyl]amino]butanoate |
| SMILES | COCCn1cc([C@@H]2[C@@H](C(=O)NCCCC(=O)OC)CC(=O)N2C(C)(C)C)cn1 |
| InChI | InChI=1S/C20H32N4O5/c1-20(2,3)24-16(25)11-15(19(27)21-8-6-7-17(26)29-5)18(24)14-12-22-23(13-14)9-10-28-4/h12-13,15,18H,6-11H2,1-5H3,(H,21,27)/t15-,18+/m0/s1 |
| InChIKey | FXTGLKTZZYJZBY-MAUKXSAKSA-N |
| XLogP | 1.29 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|