C15H21N7O2 — CID 124844498
N-ethyl-3-[[2-[[(1R)-1-(1-methyltetrazol-5-yl)ethyl]amino]acetyl]amino]benzamide (PubChem CID 124844498) has the molecular formula C15H21N7O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-ethyl-3-[[2-[[(1R)-1-(1-methyltetrazol-5-yl)ethyl]amino]acetyl]amino]benzamide.
| Compound Name | N-ethyl-3-[[2-[[(1R)-1-(1-methyltetrazol-5-yl)ethyl]amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 124844498 |
| Molecular Formula | C15H21N7O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N-ethyl-3-[[2-[[(1R)-1-(1-methyltetrazol-5-yl)ethyl]amino]acetyl]amino]benzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)CN[C@H](C)c2nnnn2C)c1 |
| InChI | InChI=1S/C15H21N7O2/c1-4-16-15(24)11-6-5-7-12(8-11)18-13(23)9-17-10(2)14-19-20-21-22(14)3/h5-8,10,17H,4,9H2,1-3H3,(H,16,24)(H,18,23)/t10-/m1/s1 |
| InChIKey | GKMLWMIEDQITMY-SNVBAGLBSA-N |
| XLogP | 0.25 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |