C11H20F3NOS — CID 124844652
(3R)-1-(2-tert-butylsulfanylethyl)-3-(trifluoromethyl)pyrrolidin-3-ol (PubChem CID 124844652) has the molecular formula C11H20F3NOS and a molecular weight of 271.35 g/mol. Its IUPAC name is (3R)-1-(2-tert-butylsulfanylethyl)-3-(trifluoromethyl)pyrrolidin-3-ol.
| Compound Name | (3R)-1-(2-tert-butylsulfanylethyl)-3-(trifluoromethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 124844652 |
| Molecular Formula | C11H20F3NOS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (3R)-1-(2-tert-butylsulfanylethyl)-3-(trifluoromethyl)pyrrolidin-3-ol |
| SMILES | CC(C)(C)SCCN1CC[C@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H20F3NOS/c1-9(2,3)17-7-6-15-5-4-10(16,8-15)11(12,13)14/h16H,4-8H2,1-3H3/t10-/m1/s1 |
| InChIKey | GOSGBBJZRAQKHY-SNVBAGLBSA-N |
| XLogP | 2.52 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |