C13H17N5O3S — CID 124845298
N-[(1R)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-4-methoxybenzenesulfonamide (PubChem CID 124845298) has the molecular formula C13H17N5O3S and a molecular weight of 323.38 g/mol. Its IUPAC name is N-[(1R)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[(1R)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 124845298 |
| Molecular Formula | C13H17N5O3S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-[(1R)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C)c2nnnn2C2CC2)cc1 |
| InChI | InChI=1S/C13H17N5O3S/c1-9(13-14-16-17-18(13)10-3-4-10)15-22(19,20)12-7-5-11(21-2)6-8-12/h5-10,15H,3-4H2,1-2H3/t9-/m1/s1 |
| InChIKey | HKUYISKZEIDXOV-SECBINFHSA-N |
| XLogP | 1.06 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |