C13H24N2O2 — CID 124845733
(2R)-N,N-diethyl-1-[[(2S)-oxiran-2-yl]methyl]piperidine-2-carboxamide (PubChem CID 124845733) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (2R)-N,N-diethyl-1-[[(2S)-oxiran-2-yl]methyl]piperidine-2-carboxamide.
| Compound Name | (2R)-N,N-diethyl-1-[[(2S)-oxiran-2-yl]methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 124845733 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | (2R)-N,N-diethyl-1-[[(2S)-oxiran-2-yl]methyl]piperidine-2-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1CCCCN1C[C@H]1CO1 |
| InChI | InChI=1S/C13H24N2O2/c1-3-14(4-2)13(16)12-7-5-6-8-15(12)9-11-10-17-11/h11-12H,3-10H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | SESQQHGOEZIHFX-NWDGAFQWSA-N |
| XLogP | 1.11 |
| TPSA | 36.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|