C17H14F4N6 — CID 124845821
N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-4-phenyl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 124845821) has the molecular formula C17H14F4N6 and a molecular weight of 378.33 g/mol. Its IUPAC name is N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-4-phenyl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-4-phenyl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 124845821 |
| Molecular Formula | C17H14F4N6 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-4-phenyl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1nn(C)c(F)c1/C=N\Nc1nc(-c2ccccc2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C17H14F4N6/c1-10-12(15(18)27(2)26-10)9-22-25-16-23-13(11-6-4-3-5-7-11)8-14(24-16)17(19,20)21/h3-9H,1-2H3,(H,23,24,25)/b22-9- |
| InChIKey | HUBDGEZBRUDFTO-AFPJDJCSSA-N |
| XLogP | 3.79 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|