C12H20N6O2 — CID 124846176
(2S)-N-[(2-methyltetrazol-5-yl)methyl]-2-[(2S)-oxolan-2-yl]pyrrolidine-1-carboxamide (PubChem CID 124846176) has the molecular formula C12H20N6O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is (2S)-N-[(2-methyltetrazol-5-yl)methyl]-2-[(2S)-oxolan-2-yl]pyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-[(2-methyltetrazol-5-yl)methyl]-2-[(2S)-oxolan-2-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 124846176 |
| Molecular Formula | C12H20N6O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (2S)-N-[(2-methyltetrazol-5-yl)methyl]-2-[(2S)-oxolan-2-yl]pyrrolidine-1-carboxamide |
| SMILES | Cn1nnc(CNC(=O)N2CCC[C@H]2[C@@H]2CCCO2)n1 |
| InChI | InChI=1S/C12H20N6O2/c1-17-15-11(14-16-17)8-13-12(19)18-6-2-4-9(18)10-5-3-7-20-10/h9-10H,2-8H2,1H3,(H,13,19)/t9-,10-/m0/s1 |
| InChIKey | IHMQBVGWVHNRMV-UWVGGRQHSA-N |
| XLogP | 0.06 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |