About 3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine
3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine (PubChem CID 124846370) has the molecular formula C15H24N4O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine.
Molecular Properties
| Compound Name | 3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine |
| PubChem CID | 124846370 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine |
| SMILES | Cc1cnc(C)c(N2CCN(C[C@@H]3COCCO3)CC2)n1 |
| InChI | InChI=1S/C15H24N4O2/c1-12-9-16-13(2)15(17-12)19-5-3-18(4-6-19)10-14-11-20-7-8-21-14/h9,14H,3-8,10-11H2,1-2H3/t14-/m1/s1 |
| InChIKey | IRHZYDKKHAIFQR-CQSZACIVSA-N |
| XLogP | 0.63 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine?
The IUPAC name of 3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine (CID 124846370) is 3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine.
What is the SMILES notation for 3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine?
The canonical SMILES for 3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine is Cc1cnc(C)c(N2CCN(C[C@@H]3COCCO3)CC2)n1.
What is the InChIKey of 3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine?
The InChIKey is IRHZYDKKHAIFQR-CQSZACIVSA-N. The full InChI is InChI=1S/C15H24N4O2/c1-12-9-16-13(2)15(17-12)19-5-3-18(4-6-19)10-14-11-20-7-8-21-14/h9,14H,3-8,10-11H2,1-2H3/t14-/m1/s1.
What are the key properties of 3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine?
3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine has a molecular weight of 292.38 g/mol, XLogP of 0.63, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[[(2R)-1,4-dioxan-2-yl]methyl]piperazin-1-yl]-2,5-dimethylpyrazine is sourced from PubChem (CID 124846370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).