C19H29FN4O — CID 124846478
2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-N-[1-(4-fluorophenyl)piperidin-4-yl]acetamide (PubChem CID 124846478) has the molecular formula C19H29FN4O and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-N-[1-(4-fluorophenyl)piperidin-4-yl]acetamide.
| Compound Name | 2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-N-[1-(4-fluorophenyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 124846478 |
| Molecular Formula | C19H29FN4O |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-N-[1-(4-fluorophenyl)piperidin-4-yl]acetamide |
| SMILES | CN(C)[C@@H]1CCN(CC(=O)NC2CCN(c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C19H29FN4O/c1-22(2)18-9-10-23(13-18)14-19(25)21-16-7-11-24(12-8-16)17-5-3-15(20)4-6-17/h3-6,16,18H,7-14H2,1-2H3,(H,21,25)/t18-/m1/s1 |
| InChIKey | IVPQNTNWXWFWGV-GOSISDBHSA-N |
| XLogP | 1.55 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |