C18H20FIN2O2 — CID 124847450
methyl (6R)-2-[3-(3-fluorophenyl)propyl]-3-iodo-4,5,6,7-tetrahydroindazole-6-carboxylate (PubChem CID 124847450) has the molecular formula C18H20FIN2O2 and a molecular weight of 442.27 g/mol. Its IUPAC name is methyl (6R)-2-[3-(3-fluorophenyl)propyl]-3-iodo-4,5,6,7-tetrahydroindazole-6-carboxylate.
| Compound Name | methyl (6R)-2-[3-(3-fluorophenyl)propyl]-3-iodo-4,5,6,7-tetrahydroindazole-6-carboxylate |
|---|---|
| PubChem CID | 124847450 |
| Molecular Formula | C18H20FIN2O2 |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | methyl (6R)-2-[3-(3-fluorophenyl)propyl]-3-iodo-4,5,6,7-tetrahydroindazole-6-carboxylate |
| SMILES | COC(=O)[C@@H]1CCc2c(nn(CCCc3cccc(F)c3)c2I)C1 |
| InChI | InChI=1S/C18H20FIN2O2/c1-24-18(23)13-7-8-15-16(11-13)21-22(17(15)20)9-3-5-12-4-2-6-14(19)10-12/h2,4,6,10,13H,3,5,7-9,11H2,1H3/t13-/m1/s1 |
| InChIKey | KVYDTFIFBBIGGB-CYBMUJFWSA-N |
| XLogP | 3.54 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|