C19H26N4O2 — CID 124848711
N-[(1R,3S)-3-butoxy-2,2-dimethylcyclobutyl]-N-methylpyrido[2,3-b]pyrazine-6-carboxamide (PubChem CID 124848711) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[(1R,3S)-3-butoxy-2,2-dimethylcyclobutyl]-N-methylpyrido[2,3-b]pyrazine-6-carboxamide.
| Compound Name | N-[(1R,3S)-3-butoxy-2,2-dimethylcyclobutyl]-N-methylpyrido[2,3-b]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 124848711 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[(1R,3S)-3-butoxy-2,2-dimethylcyclobutyl]-N-methylpyrido[2,3-b]pyrazine-6-carboxamide |
| SMILES | CCCCO[C@H]1C[C@@H](N(C)C(=O)c2ccc3nccnc3n2)C1(C)C |
| InChI | InChI=1S/C19H26N4O2/c1-5-6-11-25-16-12-15(19(16,2)3)23(4)18(24)14-8-7-13-17(22-14)21-10-9-20-13/h7-10,15-16H,5-6,11-12H2,1-4H3/t15-,16+/m1/s1 |
| InChIKey | NGZUXOTXBFWZDG-CVEARBPZSA-N |
| XLogP | 3.08 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|