C15H28N2O4S — CID 124849042
1-[(2S)-4-methylsulfonylbutan-2-yl]-3-[(4R)-8-oxaspiro[4.5]decan-4-yl]urea (PubChem CID 124849042) has the molecular formula C15H28N2O4S and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-[(2S)-4-methylsulfonylbutan-2-yl]-3-[(4R)-8-oxaspiro[4.5]decan-4-yl]urea.
| Compound Name | 1-[(2S)-4-methylsulfonylbutan-2-yl]-3-[(4R)-8-oxaspiro[4.5]decan-4-yl]urea |
|---|---|
| PubChem CID | 124849042 |
| Molecular Formula | C15H28N2O4S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[(2S)-4-methylsulfonylbutan-2-yl]-3-[(4R)-8-oxaspiro[4.5]decan-4-yl]urea |
| SMILES | C[C@@H](CCS(C)(=O)=O)NC(=O)N[C@@H]1CCCC12CCOCC2 |
| InChI | InChI=1S/C15H28N2O4S/c1-12(5-11-22(2,19)20)16-14(18)17-13-4-3-6-15(13)7-9-21-10-8-15/h12-13H,3-11H2,1-2H3,(H2,16,17,18)/t12-,13+/m0/s1 |
| InChIKey | NXNYKBMWGZDGFY-QWHCGFSZSA-N |
| XLogP | 1.46 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |