C14H12F4N4OS — CID 124849150
2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]acetamide (PubChem CID 124849150) has the molecular formula C14H12F4N4OS and a molecular weight of 360.34 g/mol. Its IUPAC name is 2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 124849150 |
| Molecular Formula | C14H12F4N4OS |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]acetamide |
| SMILES | O=C(Cn1nc(C(F)(F)F)cc1C1CC1)N/N=C\c1ccc(F)s1 |
| InChI | InChI=1S/C14H12F4N4OS/c15-12-4-3-9(24-12)6-19-20-13(23)7-22-10(8-1-2-8)5-11(21-22)14(16,17)18/h3-6,8H,1-2,7H2,(H,20,23)/b19-6- |
| InChIKey | OBYGVCMEIWHVLM-SWNXQHNESA-N |
| XLogP | 3.13 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|