C22H22N4O3 — CID 124850734
N-[(1R)-1-[1-(2-methoxyethyl)benzimidazol-2-yl]ethyl]-1-oxo-2H-isoquinoline-4-carboxamide (PubChem CID 124850734) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-[(1R)-1-[1-(2-methoxyethyl)benzimidazol-2-yl]ethyl]-1-oxo-2H-isoquinoline-4-carboxamide.
| Compound Name | N-[(1R)-1-[1-(2-methoxyethyl)benzimidazol-2-yl]ethyl]-1-oxo-2H-isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 124850734 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-[(1R)-1-[1-(2-methoxyethyl)benzimidazol-2-yl]ethyl]-1-oxo-2H-isoquinoline-4-carboxamide |
| SMILES | COCCn1c([C@@H](C)NC(=O)c2c[nH]c(=O)c3ccccc23)nc2ccccc21 |
| InChI | InChI=1S/C22H22N4O3/c1-14(20-25-18-9-5-6-10-19(18)26(20)11-12-29-2)24-22(28)17-13-23-21(27)16-8-4-3-7-15(16)17/h3-10,13-14H,11-12H2,1-2H3,(H,23,27)(H,24,28)/t14-/m1/s1 |
| InChIKey | QYLVKSBQLSOZLS-CQSZACIVSA-N |
| XLogP | 3.02 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |