C16H23N3O2S — CID 124852723
(3S)-3-[methyl-[methyl-[(E)-2-methyl-3-phenylprop-2-enyl]sulfamoyl]amino]butanenitrile (PubChem CID 124852723) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is (3S)-3-[methyl-[methyl-[(E)-2-methyl-3-phenylprop-2-enyl]sulfamoyl]amino]butanenitrile.
| Compound Name | (3S)-3-[methyl-[methyl-[(E)-2-methyl-3-phenylprop-2-enyl]sulfamoyl]amino]butanenitrile |
|---|---|
| PubChem CID | 124852723 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (3S)-3-[methyl-[methyl-[(E)-2-methyl-3-phenylprop-2-enyl]sulfamoyl]amino]butanenitrile |
| SMILES | C/C(=C\c1ccccc1)CN(C)S(=O)(=O)N(C)[C@@H](C)CC#N |
| InChI | InChI=1S/C16H23N3O2S/c1-14(12-16-8-6-5-7-9-16)13-18(3)22(20,21)19(4)15(2)10-11-17/h5-9,12,15H,10,13H2,1-4H3/b14-12+/t15-/m0/s1 |
| InChIKey | VHNXSPDVUYDPKQ-ZQHYZAEZSA-N |
| XLogP | 2.50 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |