C21H27N5OSi — CID 124852726
3-[[dimethyl(phenyl)silyl]methyl]-1-methyl-1-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]urea (PubChem CID 124852726) has the molecular formula C21H27N5OSi and a molecular weight of 393.57 g/mol. Its IUPAC name is 3-[[dimethyl(phenyl)silyl]methyl]-1-methyl-1-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]urea.
| Compound Name | 3-[[dimethyl(phenyl)silyl]methyl]-1-methyl-1-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 124852726 |
| Molecular Formula | C21H27N5OSi |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 3-[[dimethyl(phenyl)silyl]methyl]-1-methyl-1-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]urea |
| SMILES | C[C@@H](c1ccc(-n2cncn2)cc1)N(C)C(=O)NC[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H27N5OSi/c1-17(18-10-12-19(13-11-18)26-15-22-14-24-26)25(2)21(27)23-16-28(3,4)20-8-6-5-7-9-20/h5-15,17H,16H2,1-4H3,(H,23,27)/t17-/m0/s1 |
| InChIKey | VHPUPOVLASDCLJ-KRWDZBQOSA-N |
| XLogP | 3.12 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|