C20H34N2O2 — CID 124853069
(2R,4S,4aR,8aR)-N-[(2R)-butan-2-yl]-2-methyl-1-pent-4-enoyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxamide (PubChem CID 124853069) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is (2R,4S,4aR,8aR)-N-[(2R)-butan-2-yl]-2-methyl-1-pent-4-enoyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxamide.
| Compound Name | (2R,4S,4aR,8aR)-N-[(2R)-butan-2-yl]-2-methyl-1-pent-4-enoyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 124853069 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | (2R,4S,4aR,8aR)-N-[(2R)-butan-2-yl]-2-methyl-1-pent-4-enoyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxamide |
| SMILES | C=CCCC(=O)N1[C@H](C)C[C@H](C(=O)N[C@H](C)CC)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C20H34N2O2/c1-5-7-12-19(23)22-15(4)13-17(20(24)21-14(3)6-2)16-10-8-9-11-18(16)22/h5,14-18H,1,6-13H2,2-4H3,(H,21,24)/t14-,15-,16-,17+,18-/m1/s1 |
| InChIKey | IGRYUUATXRLVBY-HSFUPAIVSA-N |
| XLogP | 3.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|