C19H24N2O2 — CID 124854159
1-(cyclopropylmethyl)-N-[2-[(2R)-oxolan-2-yl]ethyl]indole-2-carboxamide (PubChem CID 124854159) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-N-[2-[(2R)-oxolan-2-yl]ethyl]indole-2-carboxamide.
| Compound Name | 1-(cyclopropylmethyl)-N-[2-[(2R)-oxolan-2-yl]ethyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 124854159 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-(cyclopropylmethyl)-N-[2-[(2R)-oxolan-2-yl]ethyl]indole-2-carboxamide |
| SMILES | O=C(NCC[C@H]1CCCO1)c1cc2ccccc2n1CC1CC1 |
| InChI | InChI=1S/C19H24N2O2/c22-19(20-10-9-16-5-3-11-23-16)18-12-15-4-1-2-6-17(15)21(18)13-14-7-8-14/h1-2,4,6,12,14,16H,3,5,7-11,13H2,(H,20,22)/t16-/m1/s1 |
| InChIKey | WSQKUPAEUGRPPJ-MRXNPFEDSA-N |
| XLogP | 3.35 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |