C17H20FN3O3 — CID 124854260
(2S)-N-(2-fluoroethyl)-2-[[(S)-furan-2-yl(phenyl)methyl]carbamoylamino]propanamide (PubChem CID 124854260) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is (2S)-N-(2-fluoroethyl)-2-[[(S)-furan-2-yl(phenyl)methyl]carbamoylamino]propanamide.
| Compound Name | (2S)-N-(2-fluoroethyl)-2-[[(S)-furan-2-yl(phenyl)methyl]carbamoylamino]propanamide |
|---|---|
| PubChem CID | 124854260 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (2S)-N-(2-fluoroethyl)-2-[[(S)-furan-2-yl(phenyl)methyl]carbamoylamino]propanamide |
| SMILES | C[C@H](NC(=O)N[C@@H](c1ccccc1)c1ccco1)C(=O)NCCF |
| InChI | InChI=1S/C17H20FN3O3/c1-12(16(22)19-10-9-18)20-17(23)21-15(14-8-5-11-24-14)13-6-3-2-4-7-13/h2-8,11-12,15H,9-10H2,1H3,(H,19,22)(H2,20,21,23)/t12-,15-/m0/s1 |
| InChIKey | WWDCNBAWLCSKMI-WFASDCNBSA-N |
| XLogP | 2.14 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |