C17H21N3O5 — CID 124854745
methyl (2R)-2-[[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]acetyl]amino]-4-methylpentanoate (PubChem CID 124854745) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is methyl (2R)-2-[[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]acetyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]acetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 124854745 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | methyl (2R)-2-[[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]acetyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)Cn1nc(-c2ccco2)ccc1=O |
| InChI | InChI=1S/C17H21N3O5/c1-11(2)9-13(17(23)24-3)18-15(21)10-20-16(22)7-6-12(19-20)14-5-4-8-25-14/h4-8,11,13H,9-10H2,1-3H3,(H,18,21)/t13-/m1/s1 |
| InChIKey | XTMYSMQBHWGUHT-CYBMUJFWSA-N |
| XLogP | 1.21 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |