C15H20Cl2N2O — CID 124856081
(1R,5S,6R)-N-[(3,6-dichloro-2-pyridinyl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine (PubChem CID 124856081) has the molecular formula C15H20Cl2N2O and a molecular weight of 315.24 g/mol. Its IUPAC name is (1R,5S,6R)-N-[(3,6-dichloro-2-pyridinyl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine.
| Compound Name | (1R,5S,6R)-N-[(3,6-dichloro-2-pyridinyl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine |
|---|---|
| PubChem CID | 124856081 |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (1R,5S,6R)-N-[(3,6-dichloro-2-pyridinyl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine |
| SMILES | CN(Cc1nc(Cl)ccc1Cl)[C@@H]1[C@@H]2CCO[C@H]2C1(C)C |
| InChI | InChI=1S/C15H20Cl2N2O/c1-15(2)13(9-6-7-20-14(9)15)19(3)8-11-10(16)4-5-12(17)18-11/h4-5,9,13-14H,6-8H2,1-3H3/t9-,13+,14+/m0/s1 |
| InChIKey | FAXDSRUDOPEUIA-CUOATXAZSA-N |
| XLogP | 3.63 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|