C16H26N6O — CID 124856814
3-[1-(3-cyanopropyl)pyrazol-3-yl]-1-[(3R,4R)-1,3-dimethylpiperidin-4-yl]-1-methylurea (PubChem CID 124856814) has the molecular formula C16H26N6O and a molecular weight of 318.43 g/mol. Its IUPAC name is 3-[1-(3-cyanopropyl)pyrazol-3-yl]-1-[(3R,4R)-1,3-dimethylpiperidin-4-yl]-1-methylurea.
| Compound Name | 3-[1-(3-cyanopropyl)pyrazol-3-yl]-1-[(3R,4R)-1,3-dimethylpiperidin-4-yl]-1-methylurea |
|---|---|
| PubChem CID | 124856814 |
| Molecular Formula | C16H26N6O |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 3-[1-(3-cyanopropyl)pyrazol-3-yl]-1-[(3R,4R)-1,3-dimethylpiperidin-4-yl]-1-methylurea |
| SMILES | C[C@@H]1CN(C)CC[C@H]1N(C)C(=O)Nc1ccn(CCCC#N)n1 |
| InChI | InChI=1S/C16H26N6O/c1-13-12-20(2)10-6-14(13)21(3)16(23)18-15-7-11-22(19-15)9-5-4-8-17/h7,11,13-14H,4-6,9-10,12H2,1-3H3,(H,18,19,23)/t13-,14-/m1/s1 |
| InChIKey | SLQLAGOZNCAIEM-ZIAGYGMSSA-N |
| XLogP | 1.99 |
| TPSA | 77.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|