C17H28N2O — CID 124856845
(2S)-1-[(3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-cyclopropyl-2-pyrrolidin-1-ylethanone (PubChem CID 124856845) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is (2S)-1-[(3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-cyclopropyl-2-pyrrolidin-1-ylethanone.
| Compound Name | (2S)-1-[(3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-cyclopropyl-2-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 124856845 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | (2S)-1-[(3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-cyclopropyl-2-pyrrolidin-1-ylethanone |
| SMILES | O=C([C@H](C1CC1)N1CCCC1)N1C[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C17H28N2O/c20-17(16(13-7-8-13)18-9-3-4-10-18)19-11-14-5-1-2-6-15(14)12-19/h13-16H,1-12H2/t14-,15-,16-/m0/s1 |
| InChIKey | UAESFQWKKPKMDN-JYJNAYRXSA-N |
| XLogP | 2.51 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |