C19H26N2O2S — CID 124856927
1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-[[(1R,5S,6R)-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl]amino]ethanone (PubChem CID 124856927) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-[[(1R,5S,6R)-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl]amino]ethanone.
| Compound Name | 1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-[[(1R,5S,6R)-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl]amino]ethanone |
|---|---|
| PubChem CID | 124856927 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-[[(1R,5S,6R)-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl]amino]ethanone |
| SMILES | O=C(CN[C@@H]1[C@@H]2CCO[C@H]2C12CCCC2)N1CCc2sccc2C1 |
| InChI | InChI=1S/C19H26N2O2S/c22-16(21-8-3-15-13(12-21)5-10-24-15)11-20-17-14-4-9-23-18(14)19(17)6-1-2-7-19/h5,10,14,17-18,20H,1-4,6-9,11-12H2/t14-,17+,18+/m0/s1 |
| InChIKey | VLPUOPJEDCQPJD-BMGDILEWSA-N |
| XLogP | 2.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |