C23H30O5 — CID 124858151
6-[(2E,4E,6E)-4,6-dimethyl-7-[(1S,2S,4R,5S)-2,4,5-trimethyl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]hepta-2,4,6-trien-2-yl]-4-methoxy-5-methylpyran-2-one (PubChem CID 124858151) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 6-[(2E,4E,6E)-4,6-dimethyl-7-[(1S,2S,4R,5S)-2,4,5-trimethyl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]hepta-2,4,6-trien-2-yl]-4-methoxy-5-methylpyran-2-one.
| Compound Name | 6-[(2E,4E,6E)-4,6-dimethyl-7-[(1S,2S,4R,5S)-2,4,5-trimethyl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]hepta-2,4,6-trien-2-yl]-4-methoxy-5-methylpyran-2-one |
|---|---|
| PubChem CID | 124858151 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 6-[(2E,4E,6E)-4,6-dimethyl-7-[(1S,2S,4R,5S)-2,4,5-trimethyl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]hepta-2,4,6-trien-2-yl]-4-methoxy-5-methylpyran-2-one |
| SMILES | COc1cc(=O)oc(/C(C)=C/C(C)=C/C(C)=C/[C@]2(C)O[C@H](C)[C@]3(C)O[C@H]32)c1C |
| InChI | InChI=1S/C23H30O5/c1-13(10-15(3)20-16(4)18(25-8)11-19(24)26-20)9-14(2)12-22(6)21-23(7,28-21)17(5)27-22/h9-12,17,21H,1-8H3/b13-9+,14-12+,15-10+/t17-,21+,22+,23+/m1/s1 |
| InChIKey | LRRJYOPCACBLEA-KLDUGXKXSA-N |
| XLogP | 4.59 |
| TPSA | 61.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|