C18H16F3N5 — CID 1248583
2-N,2-N-dibenzyl-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 1248583) has the molecular formula C18H16F3N5 and a molecular weight of 359.36 g/mol. Its IUPAC name is 2-N,2-N-dibenzyl-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dibenzyl-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 1248583 |
| Molecular Formula | C18H16F3N5 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-N,2-N-dibenzyl-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N(Cc2ccccc2)Cc2ccccc2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C18H16F3N5/c19-18(20,21)15-23-16(22)25-17(24-15)26(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H2,22,23,24,25) |
| InChIKey | YZCBLNSQBWYLOI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |