C20H34N2O — CID 124859177
(2R)-2-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propan-1-one (PubChem CID 124859177) has the molecular formula C20H34N2O and a molecular weight of 318.51 g/mol. Its IUPAC name is (2R)-2-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propan-1-one.
| Compound Name | (2R)-2-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 124859177 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | (2R)-2-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propan-1-one |
| SMILES | C[C@H](C(=O)N1[C@H](C)CCC[C@@H]1C)N1CCC[C@]2(CC=CCC2)C1 |
| InChI | InChI=1S/C20H34N2O/c1-16-9-7-10-17(2)22(16)19(23)18(3)21-14-8-13-20(15-21)11-5-4-6-12-20/h4-5,16-18H,6-15H2,1-3H3/t16-,17+,18-,20-/m1/s1 |
| InChIKey | WTUXWCSSBUOUSE-AJYBTWMASA-N |
| XLogP | 3.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|