C17H13NO3S — CID 124859295
(1S,2R,3S)-2-(benzenesulfonyl)-1-formyl-3-phenylcyclopropane-1-carbonitrile (PubChem CID 124859295) has the molecular formula C17H13NO3S and a molecular weight of 311.36 g/mol. Its IUPAC name is (1S,2R,3S)-2-(benzenesulfonyl)-1-formyl-3-phenylcyclopropane-1-carbonitrile.
| Compound Name | (1S,2R,3S)-2-(benzenesulfonyl)-1-formyl-3-phenylcyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 124859295 |
| Molecular Formula | C17H13NO3S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (1S,2R,3S)-2-(benzenesulfonyl)-1-formyl-3-phenylcyclopropane-1-carbonitrile |
| SMILES | N#C[C@]1(C=O)[C@H](c2ccccc2)[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H13NO3S/c18-11-17(12-19)15(13-7-3-1-4-8-13)16(17)22(20,21)14-9-5-2-6-10-14/h1-10,12,15-16H/t15-,16-,17+/m1/s1 |
| InChIKey | XQDTZJRELDUSEJ-ZACQAIPSSA-N |
| XLogP | 2.34 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|