About 1,2,4,5-tetrabromobenzene
1,2,4,5-tetrabromobenzene (PubChem CID 12486) has the molecular formula C6H2Br4
and a molecular weight of 393.70 g/mol. Its IUPAC name is 1,2,4,5-tetrabromobenzene.
Molecular Properties
| Compound Name | 1,2,4,5-tetrabromobenzene |
| PubChem CID | 12486 |
| Molecular Formula | C6H2Br4 |
| Molecular Weight | 393.70 g/mol |
| Exact Mass | 389.69 |
| IUPAC Name | 1,2,4,5-tetrabromobenzene |
| SMILES | Brc1cc(Br)c(Br)cc1Br |
| InChI | InChI=1S/C6H2Br4/c7-3-1-4(8)6(10)2-5(3)9/h1-2H |
| InChIKey | QCKHVNQHBOGZER-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1,2,4,5-tetrabromobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4,5-tetrabromobenzene?
The IUPAC name of 1,2,4,5-tetrabromobenzene (CID 12486) is 1,2,4,5-tetrabromobenzene.
What is the SMILES notation for 1,2,4,5-tetrabromobenzene?
The canonical SMILES for 1,2,4,5-tetrabromobenzene is Brc1cc(Br)c(Br)cc1Br.
What is the InChIKey of 1,2,4,5-tetrabromobenzene?
The InChIKey is QCKHVNQHBOGZER-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Br4/c7-3-1-4(8)6(10)2-5(3)9/h1-2H.
What are the key properties of 1,2,4,5-tetrabromobenzene?
1,2,4,5-tetrabromobenzene has a molecular weight of 393.70 g/mol, XLogP of 4.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4,5-tetrabromobenzene is sourced from PubChem (CID 12486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).