C15H27N3O4S — CID 124860987
(4aR,8aS)-N-(2-cyanoethyl)-4a-hydroxy-N-(2-methoxyethyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-sulfonamide (PubChem CID 124860987) has the molecular formula C15H27N3O4S and a molecular weight of 345.47 g/mol. Its IUPAC name is (4aR,8aS)-N-(2-cyanoethyl)-4a-hydroxy-N-(2-methoxyethyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-sulfonamide.
| Compound Name | (4aR,8aS)-N-(2-cyanoethyl)-4a-hydroxy-N-(2-methoxyethyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-sulfonamide |
|---|---|
| PubChem CID | 124860987 |
| Molecular Formula | C15H27N3O4S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (4aR,8aS)-N-(2-cyanoethyl)-4a-hydroxy-N-(2-methoxyethyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-sulfonamide |
| SMILES | COCCN(CCC#N)S(=O)(=O)N1CC[C@]2(O)CCCC[C@H]2C1 |
| InChI | InChI=1S/C15H27N3O4S/c1-22-12-11-17(9-4-8-16)23(20,21)18-10-7-15(19)6-3-2-5-14(15)13-18/h14,19H,2-7,9-13H2,1H3/t14-,15+/m0/s1 |
| InChIKey | FPLYKQXZWHPXHB-LSDHHAIUSA-N |
| XLogP | 0.72 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |