C18H24F3N3O3 — CID 124861798
(3S)-3-[[(2R,3R)-3-methyl-4-(2-nitrophenyl)butan-2-yl]amino]-1-(2,2,2-trifluoroethyl)piperidin-2-one (PubChem CID 124861798) has the molecular formula C18H24F3N3O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is (3S)-3-[[(2R,3R)-3-methyl-4-(2-nitrophenyl)butan-2-yl]amino]-1-(2,2,2-trifluoroethyl)piperidin-2-one.
| Compound Name | (3S)-3-[[(2R,3R)-3-methyl-4-(2-nitrophenyl)butan-2-yl]amino]-1-(2,2,2-trifluoroethyl)piperidin-2-one |
|---|---|
| PubChem CID | 124861798 |
| Molecular Formula | C18H24F3N3O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (3S)-3-[[(2R,3R)-3-methyl-4-(2-nitrophenyl)butan-2-yl]amino]-1-(2,2,2-trifluoroethyl)piperidin-2-one |
| SMILES | C[C@H](Cc1ccccc1[N+](=O)[O-])[C@@H](C)N[C@H]1CCCN(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C18H24F3N3O3/c1-12(10-14-6-3-4-8-16(14)24(26)27)13(2)22-15-7-5-9-23(17(15)25)11-18(19,20)21/h3-4,6,8,12-13,15,22H,5,7,9-11H2,1-2H3/t12-,13-,15+/m1/s1 |
| InChIKey | JRYVQVSWNRULKX-NFAWXSAZSA-N |
| XLogP | 3.30 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|