C21H23N3O5 — CID 124862347
N-[(1S)-2-hydroxy-1-phenylethyl]-2-[(4R)-1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 124862347) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[(1S)-2-hydroxy-1-phenylethyl]-2-[(4R)-1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-[(1S)-2-hydroxy-1-phenylethyl]-2-[(4R)-1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 124862347 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[(1S)-2-hydroxy-1-phenylethyl]-2-[(4R)-1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | COc1ccc(CN2C(=O)N[C@H](CC(=O)N[C@H](CO)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C21H23N3O5/c1-29-16-9-7-14(8-10-16)12-24-20(27)17(23-21(24)28)11-19(26)22-18(13-25)15-5-3-2-4-6-15/h2-10,17-18,25H,11-13H2,1H3,(H,22,26)(H,23,28)/t17-,18-/m1/s1 |
| InChIKey | MNICJZFMGKSSRK-QZTJIDSGSA-N |
| XLogP | 1.36 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|